Русские видео

Сейчас в тренде

Иностранные видео


Скачать с ютуб How many stereoisomers possible? [KLEIN] Organic Chemistry в хорошем качестве

How many stereoisomers possible? [KLEIN] Organic Chemistry 4 года назад


Если кнопки скачивания не загрузились НАЖМИТЕ ЗДЕСЬ или обновите страницу
Если возникают проблемы со скачиванием, пожалуйста напишите в поддержку по адресу внизу страницы.
Спасибо за использование сервиса savevideohd.ru



How many stereoisomers possible? [KLEIN] Organic Chemistry

This problem comes from Chapter 5 of Klein's 2nd edition organic chemistry textbook. 5.37 Identify the number of stereoisomers expected for each of the following. To search my channel for a particular molecule: 1. Watch this guide 2. Use the draw structure tool: https://cactus.nci.nih.gov/translate/... 3. copy and paste the ~smiles coding~ 3. Search my channel for that code (a.k.a. molecule) You will find all my videos where that molecule reacts or forms, or is discussed! ______________smiles structures_________________________________ CC(O)C(O)C(C)Cl CC(O)C(C)O CCC2CCC1(Cl)CCC(C)CC1(C)C2 CC1CCCCC1C CC1(C)C(O)C1O CC1CCCC(C(C)C(C)C(C)C(C)C)C1 ______________smiles structures_________________________________

Comments